C11H14N2 — CID 143933718
1,2,3,6-tetramethylpyrrolo[2,3-b]pyridine (PubChem CID 143933718) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,2,3,6-tetramethylpyrrolo[2,3-b]pyridine.
| Compound Name | 1,2,3,6-tetramethylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143933718 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,2,3,6-tetramethylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc2c(C)c(C)n(C)c2n1 |
| InChI | InChI=1S/C11H14N2/c1-7-5-6-10-8(2)9(3)13(4)11(10)12-7/h5-6H,1-4H3 |
| InChIKey | DLYZBZVKMXZRFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |