C33H42N10O2 — CID 171820770
3-[4-[4-[2-[4-[4-[(5-ethylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 171820770) has the molecular formula C33H42N10O2 and a molecular weight of 610.77 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[4-[(5-ethylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[4-[4-[(5-ethylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171820770 |
| Molecular Formula | C33H42N10O2 |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | 3-[4-[4-[2-[4-[4-[(5-ethylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | CCc1cnc(Nc2cnn(C3CCN(CCN4CCN(c5ccc(C6CCC(=O)NC6=O)cc5)CC4)CC3)c2)c2nccn12 |
| InChI | InChI=1S/C33H42N10O2/c1-2-26-22-35-31(32-34-11-14-42(26)32)37-25-21-36-43(23-25)28-9-12-39(13-10-28)15-16-40-17-19-41(20-18-40)27-5-3-24(4-6-27)29-7-8-30(44)38-33(29)45/h3-6,11,14,21-23,28-29H,2,7-10,12-13,15-20H2,1H3,(H,35,37)(H,38,44,45) |
| InChIKey | MGBPNKXERWQMII-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|