C37H42N10O2 — CID 171821063
3-[4-[4-[2-[4-[4-[(5-phenylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 171821063) has the molecular formula C37H42N10O2 and a molecular weight of 658.81 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[4-[(5-phenylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[2-[4-[4-[(5-phenylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171821063 |
| Molecular Formula | C37H42N10O2 |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | 3-[4-[4-[2-[4-[4-[(5-phenylimidazo[1,2-a]pyrazin-8-yl)amino]pyrazol-1-yl]piperidin-1-yl]ethyl]piperazin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccc(N3CCN(CCN4CCC(n5cc(Nc6ncc(-c7ccccc7)n7ccnc67)cn5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C37H42N10O2/c48-34-11-10-32(37(49)42-34)27-6-8-30(9-7-27)45-22-20-44(21-23-45)19-18-43-15-12-31(13-16-43)47-26-29(24-40-47)41-35-36-38-14-17-46(36)33(25-39-35)28-4-2-1-3-5-28/h1-9,14,17,24-26,31-32H,10-13,15-16,18-23H2,(H,39,41)(H,42,48,49) |
| InChIKey | LVKZMYHVZDUFRU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|