C13H15NO — CID 171821442
1-[2-[(buta-1,3-dien-2-ylamino)methyl]phenyl]ethanone (PubChem CID 171821442) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[2-[(buta-1,3-dien-2-ylamino)methyl]phenyl]ethanone.
| Compound Name | 1-[2-[(buta-1,3-dien-2-ylamino)methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 171821442 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-[2-[(buta-1,3-dien-2-ylamino)methyl]phenyl]ethanone |
| SMILES | C=CC(=C)NCc1ccccc1C(C)=O |
| InChI | InChI=1S/C13H15NO/c1-4-10(2)14-9-12-7-5-6-8-13(12)11(3)15/h4-8,14H,1-2,9H2,3H3 |
| InChIKey | NZJIBQARGYYRCQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|