C18H19N3O4 — CID 171821594
N'-[(2-acetylphenyl)methyl]-N-[4-(cyclopropylamino)-4-oxobut-2-ynyl]oxamide (PubChem CID 171821594) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N'-[(2-acetylphenyl)methyl]-N-[4-(cyclopropylamino)-4-oxobut-2-ynyl]oxamide.
| Compound Name | N'-[(2-acetylphenyl)methyl]-N-[4-(cyclopropylamino)-4-oxobut-2-ynyl]oxamide |
|---|---|
| PubChem CID | 171821594 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N'-[(2-acetylphenyl)methyl]-N-[4-(cyclopropylamino)-4-oxobut-2-ynyl]oxamide |
| SMILES | CC(=O)c1ccccc1CNC(=O)C(=O)NCC#CC(=O)NC1CC1 |
| InChI | InChI=1S/C18H19N3O4/c1-12(22)15-6-3-2-5-13(15)11-20-18(25)17(24)19-10-4-7-16(23)21-14-8-9-14/h2-3,5-6,14H,8-11H2,1H3,(H,19,24)(H,20,25)(H,21,23) |
| InChIKey | WEEMHTQFAXJFNF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|