C35H47N5O3 — CID 171822367
N'-[(2-acetylphenyl)methyl]-N-(cyanomethyl)oxamide;(1E,3Z,5Z,7Z)-1-N-cyclopropyl-2-ethenyl-1-N,3-N,3-N,6-tetramethyl-5-(1-methylcyclopropyl)nona-1,3,5,7-tetraene-1,3-diamine (PubChem CID 171822367) has the molecular formula C35H47N5O3 and a molecular weight of 585.79 g/mol. Its IUPAC name is N'-[(2-acetylphenyl)methyl]-N-(cyanomethyl)oxamide;(1E,3Z,5Z,7Z)-1-N-cyclopropyl-2-ethenyl-1-N,3-N,3-N,6-tetramethyl-5-(1-methylcyclopropyl)nona-1,3,5,7-tetraene-1,3-diamine.
| Compound Name | N'-[(2-acetylphenyl)methyl]-N-(cyanomethyl)oxamide;(1E,3Z,5Z,7Z)-1-N-cyclopropyl-2-ethenyl-1-N,3-N,3-N,6-tetramethyl-5-(1-methylcyclopropyl)nona-1,3,5,7-tetraene-1,3-diamine |
|---|---|
| PubChem CID | 171822367 |
| Molecular Formula | C35H47N5O3 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.37 |
| IUPAC Name | N'-[(2-acetylphenyl)methyl]-N-(cyanomethyl)oxamide;(1E,3Z,5Z,7Z)-1-N-cyclopropyl-2-ethenyl-1-N,3-N,3-N,6-tetramethyl-5-(1-methylcyclopropyl)nona-1,3,5,7-tetraene-1,3-diamine |
| SMILES | C=CC(=C\N(C)C1CC1)/C(=C\C(=C(C)\C=C/C)C1(C)CC1)N(C)C.CC(=O)c1ccccc1CNC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C22H34N2.C13H13N3O3/c1-8-10-17(3)20(22(4)13-14-22)15-21(23(5)6)18(9-2)16-24(7)19-11-12-19;1-9(17)11-5-3-2-4-10(11)8-16-13(19)12(18)15-7-6-14/h8-10,15-16,19H,2,11-14H2,1,3-7H3;2-5H,7-8H2,1H3,(H,15,18)(H,16,19)/b10-8-,18-16+,20-17-,21-15-; |
| InChIKey | WOGUFJFDCHAREL-RPQFAZGCSA-N |
| XLogP | 5.43 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|