C28H22ClFN4O3 — CID 174363487
N'-[[2-[2-[1-[2-chloro-3-(4-fluorophenyl)phenyl]cyclopropyl]-2-iminoacetyl]phenyl]methyl]-N-(cyanomethyl)oxamide (PubChem CID 174363487) has the molecular formula C28H22ClFN4O3 and a molecular weight of 516.96 g/mol. Its IUPAC name is N'-[[2-[2-[1-[2-chloro-3-(4-fluorophenyl)phenyl]cyclopropyl]-2-iminoacetyl]phenyl]methyl]-N-(cyanomethyl)oxamide.
| Compound Name | N'-[[2-[2-[1-[2-chloro-3-(4-fluorophenyl)phenyl]cyclopropyl]-2-iminoacetyl]phenyl]methyl]-N-(cyanomethyl)oxamide |
|---|---|
| PubChem CID | 174363487 |
| Molecular Formula | C28H22ClFN4O3 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N'-[[2-[2-[1-[2-chloro-3-(4-fluorophenyl)phenyl]cyclopropyl]-2-iminoacetyl]phenyl]methyl]-N-(cyanomethyl)oxamide |
| SMILES | [H]/N=C(\C(=O)c1ccccc1CNC(=O)C(=O)NCC#N)C1(c2cccc(-c3ccc(F)cc3)c2Cl)CC1 |
| InChI | InChI=1S/C28H22ClFN4O3/c29-23-20(17-8-10-19(30)11-9-17)6-3-7-22(23)28(12-13-28)25(32)24(35)21-5-2-1-4-18(21)16-34-27(37)26(36)33-15-14-31/h1-11,32H,12-13,15-16H2,(H,33,36)(H,34,37)/b32-25+ |
| InChIKey | DWDHSRSHOTUIPE-WGPBWIAQSA-N |
| XLogP | 4.34 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|