C29H31BN5O2 — CID 171822118
CID 171822118 (PubChem CID 171822118) has the molecular formula C29H31BN5O2 and a molecular weight of 492.41 g/mol.
| Compound Name | CID 171822118 |
|---|---|
| PubChem CID | 171822118 |
| Molecular Formula | C29H31BN5O2 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | — |
| SMILES | N#CN1CCCC1.[B]=C(NC1(c2cccc3ccccc23)CC1)c1ccccc1CNC(=O)C(=O)NC |
| InChI | InChI=1S/C24H23BN3O2.C5H8N2/c1-26-22(29)23(30)27-15-17-8-3-5-11-19(17)21(25)28-24(13-14-24)20-12-6-9-16-7-2-4-10-18(16)20;6-5-7-3-1-2-4-7/h2-12,28H,13-15H2,1H3,(H,26,29)(H,27,30);1-4H2 |
| InChIKey | LSJWEAJNEQGIFM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|