C34H29N5O4 — CID 171822396
N-[(E)-4-(3-cyanoanilino)-4-oxobut-2-enyl]-N'-[[2-[(1-naphthalen-1-ylcyclopropyl)carbamoyl]phenyl]methyl]oxamide (PubChem CID 171822396) has the molecular formula C34H29N5O4 and a molecular weight of 571.64 g/mol. Its IUPAC name is N-[(E)-4-(3-cyanoanilino)-4-oxobut-2-enyl]-N'-[[2-[(1-naphthalen-1-ylcyclopropyl)carbamoyl]phenyl]methyl]oxamide.
| Compound Name | N-[(E)-4-(3-cyanoanilino)-4-oxobut-2-enyl]-N'-[[2-[(1-naphthalen-1-ylcyclopropyl)carbamoyl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 171822396 |
| Molecular Formula | C34H29N5O4 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | N-[(E)-4-(3-cyanoanilino)-4-oxobut-2-enyl]-N'-[[2-[(1-naphthalen-1-ylcyclopropyl)carbamoyl]phenyl]methyl]oxamide |
| SMILES | N#Cc1cccc(NC(=O)/C=C/CNC(=O)C(=O)NCc2ccccc2C(=O)NC2(c3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C34H29N5O4/c35-21-23-8-5-12-26(20-23)38-30(40)16-7-19-36-32(42)33(43)37-22-25-10-2-4-14-28(25)31(41)39-34(17-18-34)29-15-6-11-24-9-1-3-13-27(24)29/h1-16,20H,17-19,22H2,(H,36,42)(H,37,43)(H,38,40)(H,39,41)/b16-7+ |
| InChIKey | VOXXPPILUVVJHS-FRKPEAEDSA-N |
| XLogP | 4.06 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|