C31H33N5O3S — CID 171821755
N-(cyanomethyl)-N'-[[2-[[1-[3-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]naphthalen-1-yl]cyclopropyl]carbamoyl]phenyl]methyl]oxamide;methanethiol (PubChem CID 171821755) has the molecular formula C31H33N5O3S and a molecular weight of 555.70 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[[2-[[1-[3-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]naphthalen-1-yl]cyclopropyl]carbamoyl]phenyl]methyl]oxamide;methanethiol.
| Compound Name | N-(cyanomethyl)-N'-[[2-[[1-[3-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]naphthalen-1-yl]cyclopropyl]carbamoyl]phenyl]methyl]oxamide;methanethiol |
|---|---|
| PubChem CID | 171821755 |
| Molecular Formula | C31H33N5O3S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | N-(cyanomethyl)-N'-[[2-[[1-[3-[(1E)-1-(methylamino)buta-1,3-dien-2-yl]naphthalen-1-yl]cyclopropyl]carbamoyl]phenyl]methyl]oxamide;methanethiol |
| SMILES | C=C/C(=C\NC)c1cc(C2(NC(=O)c3ccccc3CNC(=O)C(=O)NCC#N)CC2)c2ccccc2c1.CS |
| InChI | InChI=1S/C30H29N5O3.CH4S/c1-3-20(18-32-2)23-16-21-8-4-6-10-24(21)26(17-23)30(12-13-30)35-27(36)25-11-7-5-9-22(25)19-34-29(38)28(37)33-15-14-31;1-2/h3-11,16-18,32H,1,12-13,15,19H2,2H3,(H,33,37)(H,34,38)(H,35,36);2H,1H3/b20-18+; |
| InChIKey | VLCVMKNIIDCDCN-KPJFUTMLSA-N |
| XLogP | 3.81 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|