C27H24N4O3 — CID 171821387
N'-(1-cyanocyclopropyl)-N-[[2-[(3R)-2-imino-3-naphthalen-1-ylbutanoyl]phenyl]methyl]oxamide (PubChem CID 171821387) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is N'-(1-cyanocyclopropyl)-N-[[2-[(3R)-2-imino-3-naphthalen-1-ylbutanoyl]phenyl]methyl]oxamide.
| Compound Name | N'-(1-cyanocyclopropyl)-N-[[2-[(3R)-2-imino-3-naphthalen-1-ylbutanoyl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 171821387 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N'-(1-cyanocyclopropyl)-N-[[2-[(3R)-2-imino-3-naphthalen-1-ylbutanoyl]phenyl]methyl]oxamide |
| SMILES | [H]/N=C(\C(=O)c1ccccc1CNC(=O)C(=O)NC1(C#N)CC1)[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H24N4O3/c1-17(20-12-6-9-18-7-2-4-10-21(18)20)23(29)24(32)22-11-5-3-8-19(22)15-30-25(33)26(34)31-27(16-28)13-14-27/h2-12,17,29H,13-15H2,1H3,(H,30,33)(H,31,34)/b29-23-/t17-/m1/s1 |
| InChIKey | RNMACBUVNSNTAH-LXKSJMJGSA-N |
| XLogP | 3.63 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|