C31H33FN6O2S — CID 171822362
N-[[2-[[1-[3-[(Z,3E)-1-amino-3-(1-fluoroethylimino)prop-1-en-2-yl]naphthalen-1-yl]cyclopropyl]carbamothioyl]phenyl]methyl]-2-oxoacetamide;2-(methylamino)acetonitrile (PubChem CID 171822362) has the molecular formula C31H33FN6O2S and a molecular weight of 572.71 g/mol. Its IUPAC name is N-[[2-[[1-[3-[(Z,3E)-1-amino-3-(1-fluoroethylimino)prop-1-en-2-yl]naphthalen-1-yl]cyclopropyl]carbamothioyl]phenyl]methyl]-2-oxoacetamide;2-(methylamino)acetonitrile.
| Compound Name | N-[[2-[[1-[3-[(Z,3E)-1-amino-3-(1-fluoroethylimino)prop-1-en-2-yl]naphthalen-1-yl]cyclopropyl]carbamothioyl]phenyl]methyl]-2-oxoacetamide;2-(methylamino)acetonitrile |
|---|---|
| PubChem CID | 171822362 |
| Molecular Formula | C31H33FN6O2S |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | N-[[2-[[1-[3-[(Z,3E)-1-amino-3-(1-fluoroethylimino)prop-1-en-2-yl]naphthalen-1-yl]cyclopropyl]carbamothioyl]phenyl]methyl]-2-oxoacetamide;2-(methylamino)acetonitrile |
| SMILES | CC(F)/N=C/C(=C\N)c1cc(C2(NC(=S)c3ccccc3CNC(=O)C=O)CC2)c2ccccc2c1.CNCC#N |
| InChI | InChI=1S/C28H27FN4O2S.C3H6N2/c1-18(29)31-16-22(14-30)21-12-19-6-2-4-8-23(19)25(13-21)28(10-11-28)33-27(36)24-9-5-3-7-20(24)15-32-26(35)17-34;1-5-3-2-4/h2-9,12-14,16-18H,10-11,15,30H2,1H3,(H,32,35)(H,33,36);5H,3H2,1H3/b22-14+,31-16+; |
| InChIKey | IURMNUSGFTXQGD-IEYZDVEVSA-N |
| XLogP | 4.02 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|