C32H40N5O2P — CID 171821369
N-[[2-[[[1-[3-[(Z)-3-amino-1-methyliminobut-2-en-2-yl]-4-phosphanylphenyl]cyclopropyl]amino]-cyclobutylidenemethyl]phenyl]methyl]-2-oxoacetamide;N-methylprop-2-yn-1-amine (PubChem CID 171821369) has the molecular formula C32H40N5O2P and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[[2-[[[1-[3-[(Z)-3-amino-1-methyliminobut-2-en-2-yl]-4-phosphanylphenyl]cyclopropyl]amino]-cyclobutylidenemethyl]phenyl]methyl]-2-oxoacetamide;N-methylprop-2-yn-1-amine.
| Compound Name | N-[[2-[[[1-[3-[(Z)-3-amino-1-methyliminobut-2-en-2-yl]-4-phosphanylphenyl]cyclopropyl]amino]-cyclobutylidenemethyl]phenyl]methyl]-2-oxoacetamide;N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 171821369 |
| Molecular Formula | C32H40N5O2P |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | N-[[2-[[[1-[3-[(Z)-3-amino-1-methyliminobut-2-en-2-yl]-4-phosphanylphenyl]cyclopropyl]amino]-cyclobutylidenemethyl]phenyl]methyl]-2-oxoacetamide;N-methylprop-2-yn-1-amine |
| SMILES | C#CCNC.C/N=C/C(=C(/C)N)c1cc(C2(NC(=C3CCC3)c3ccccc3CNC(=O)C=O)CC2)ccc1P |
| InChI | InChI=1S/C28H33N4O2P.C4H7N/c1-18(29)24(16-30-2)23-14-21(10-11-25(23)35)28(12-13-28)32-27(19-7-5-8-19)22-9-4-3-6-20(22)15-31-26(34)17-33;1-3-4-5-2/h3-4,6,9-11,14,16-17,32H,5,7-8,12-13,15,29,35H2,1-2H3,(H,31,34);1,5H,4H2,2H3/b24-18+,30-16+; |
| InChIKey | YYULAGVGUDFACV-NBEGOFHDSA-N |
| XLogP | 3.41 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|