C27H31N3OS — CID 171822545
N-methylprop-2-en-1-amine;N-[[2-[(1-naphthalen-2-ylcyclopropyl)carbamothioyl]phenyl]methyl]acetamide (PubChem CID 171822545) has the molecular formula C27H31N3OS and a molecular weight of 445.63 g/mol. Its IUPAC name is N-methylprop-2-en-1-amine;N-[[2-[(1-naphthalen-2-ylcyclopropyl)carbamothioyl]phenyl]methyl]acetamide.
| Compound Name | N-methylprop-2-en-1-amine;N-[[2-[(1-naphthalen-2-ylcyclopropyl)carbamothioyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 171822545 |
| Molecular Formula | C27H31N3OS |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-methylprop-2-en-1-amine;N-[[2-[(1-naphthalen-2-ylcyclopropyl)carbamothioyl]phenyl]methyl]acetamide |
| SMILES | C=CCNC.CC(=O)NCc1ccccc1C(=S)NC1(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H22N2OS.C4H9N/c1-16(26)24-15-19-8-4-5-9-21(19)22(27)25-23(12-13-23)20-11-10-17-6-2-3-7-18(17)14-20;1-3-4-5-2/h2-11,14H,12-13,15H2,1H3,(H,24,26)(H,25,27);3,5H,1,4H2,2H3 |
| InChIKey | IIHDDUZYLQFGCH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|