C35H45ClN4O — CID 171822206
(Z)-3-[3-chloro-5-(1-methylcyclopropyl)phenyl]-4-cyclopropyliminopent-2-en-2-amine;N-methylprop-2-yn-1-amine;2-[(2-prop-1-en-2-ylphenyl)methylamino]prop-2-enal (PubChem CID 171822206) has the molecular formula C35H45ClN4O and a molecular weight of 573.23 g/mol. Its IUPAC name is (Z)-3-[3-chloro-5-(1-methylcyclopropyl)phenyl]-4-cyclopropyliminopent-2-en-2-amine;N-methylprop-2-yn-1-amine;2-[(2-prop-1-en-2-ylphenyl)methylamino]prop-2-enal.
| Compound Name | (Z)-3-[3-chloro-5-(1-methylcyclopropyl)phenyl]-4-cyclopropyliminopent-2-en-2-amine;N-methylprop-2-yn-1-amine;2-[(2-prop-1-en-2-ylphenyl)methylamino]prop-2-enal |
|---|---|
| PubChem CID | 171822206 |
| Molecular Formula | C35H45ClN4O |
| Molecular Weight | 573.23 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | (Z)-3-[3-chloro-5-(1-methylcyclopropyl)phenyl]-4-cyclopropyliminopent-2-en-2-amine;N-methylprop-2-yn-1-amine;2-[(2-prop-1-en-2-ylphenyl)methylamino]prop-2-enal |
| SMILES | C#CCNC.C/C(N)=C(C(/C)=N/C1CC1)\c1cc(Cl)cc(C2(C)CC2)c1.C=C(C=O)NCc1ccccc1C(=C)C |
| InChI | InChI=1S/C18H23ClN2.C13H15NO.C4H7N/c1-11(20)17(12(2)21-16-4-5-16)13-8-14(10-15(19)9-13)18(3)6-7-18;1-10(2)13-7-5-4-6-12(13)8-14-11(3)9-15;1-3-4-5-2/h8-10,16H,4-7,20H2,1-3H3;4-7,9,14H,1,3,8H2,2H3;1,5H,4H2,2H3/b17-11+,21-12+;; |
| InChIKey | VXZTUBZBELWGEH-MIJXXNKJSA-N |
| XLogP | 7.07 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.23 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|