C30H32ClN5O3 — CID 171822050
N'-[[2-[[1-[3-[(Z)-2-amino-4-cyclopropyliminopent-2-en-3-yl]-5-chlorophenyl]cyclopropyl]carbamoyl]phenyl]methyl]-N-prop-2-ynyloxamide (PubChem CID 171822050) has the molecular formula C30H32ClN5O3 and a molecular weight of 546.07 g/mol. Its IUPAC name is N'-[[2-[[1-[3-[(Z)-2-amino-4-cyclopropyliminopent-2-en-3-yl]-5-chlorophenyl]cyclopropyl]carbamoyl]phenyl]methyl]-N-prop-2-ynyloxamide.
| Compound Name | N'-[[2-[[1-[3-[(Z)-2-amino-4-cyclopropyliminopent-2-en-3-yl]-5-chlorophenyl]cyclopropyl]carbamoyl]phenyl]methyl]-N-prop-2-ynyloxamide |
|---|---|
| PubChem CID | 171822050 |
| Molecular Formula | C30H32ClN5O3 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | N'-[[2-[[1-[3-[(Z)-2-amino-4-cyclopropyliminopent-2-en-3-yl]-5-chlorophenyl]cyclopropyl]carbamoyl]phenyl]methyl]-N-prop-2-ynyloxamide |
| SMILES | C#CCNC(=O)C(=O)NCc1ccccc1C(=O)NC1(c2cc(Cl)cc(C(=C(\C)N)/C(C)=N/C3CC3)c2)CC1 |
| InChI | InChI=1S/C30H32ClN5O3/c1-4-13-33-28(38)29(39)34-17-20-7-5-6-8-25(20)27(37)36-30(11-12-30)22-14-21(15-23(31)16-22)26(18(2)32)19(3)35-24-9-10-24/h1,5-8,14-16,24H,9-13,17,32H2,2-3H3,(H,33,38)(H,34,39)(H,36,37)/b26-18+,35-19+ |
| InChIKey | RDRJFUDVWOLIML-WWLHWIEKSA-N |
| XLogP | 3.44 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|