C27H34N4O3 — CID 171822532
ethane;N-[1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]cyclopropyl]-2-[(oxaldehydoylamino)methyl]benzamide;N-methylprop-2-yn-1-amine (PubChem CID 171822532) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethane;N-[1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]cyclopropyl]-2-[(oxaldehydoylamino)methyl]benzamide;N-methylprop-2-yn-1-amine.
| Compound Name | ethane;N-[1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]cyclopropyl]-2-[(oxaldehydoylamino)methyl]benzamide;N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 171822532 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | ethane;N-[1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]cyclopropyl]-2-[(oxaldehydoylamino)methyl]benzamide;N-methylprop-2-yn-1-amine |
| SMILES | C#CCNC.CC.[H]/N=C1\C=CC=C(C2(NC(=O)c3ccccc3CNC(=O)C=O)CC2)\C1=C\C |
| InChI | InChI=1S/C21H21N3O3.C4H7N.C2H6/c1-2-15-17(8-5-9-18(15)22)21(10-11-21)24-20(27)16-7-4-3-6-14(16)12-23-19(26)13-25;1-3-4-5-2;1-2/h2-9,13,22H,10-12H2,1H3,(H,23,26)(H,24,27);1,5H,4H2,2H3;1-2H3/b15-2-,22-18+;; |
| InChIKey | PWXCQWSHWRLKAG-JIZLYIEYSA-N |
| XLogP | 3.09 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|