C27H26ClN3O3 — CID 171822269
N'-[(2-acetylphenyl)methyl]-N-prop-2-ynyloxamide;2-chloro-5-(1-methylcyclopropyl)quinoline (PubChem CID 171822269) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is N'-[(2-acetylphenyl)methyl]-N-prop-2-ynyloxamide;2-chloro-5-(1-methylcyclopropyl)quinoline.
| Compound Name | N'-[(2-acetylphenyl)methyl]-N-prop-2-ynyloxamide;2-chloro-5-(1-methylcyclopropyl)quinoline |
|---|---|
| PubChem CID | 171822269 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N'-[(2-acetylphenyl)methyl]-N-prop-2-ynyloxamide;2-chloro-5-(1-methylcyclopropyl)quinoline |
| SMILES | C#CCNC(=O)C(=O)NCc1ccccc1C(C)=O.CC1(c2cccc3nc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C14H14N2O3.C13H12ClN/c1-3-8-15-13(18)14(19)16-9-11-6-4-5-7-12(11)10(2)17;1-13(7-8-13)10-3-2-4-11-9(10)5-6-12(14)15-11/h1,4-7H,8-9H2,2H3,(H,15,18)(H,16,19);2-6H,7-8H2,1H3 |
| InChIKey | JYHPJIQZSJLISB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|