C30H31N3O — CID 171822123
N-but-2-ynyl-2-[[2-[1-[(1-naphthalen-1-ylcyclopropyl)amino]prop-1-enyl]phenyl]methylamino]prop-2-enamide (PubChem CID 171822123) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is N-but-2-ynyl-2-[[2-[1-[(1-naphthalen-1-ylcyclopropyl)amino]prop-1-enyl]phenyl]methylamino]prop-2-enamide.
| Compound Name | N-but-2-ynyl-2-[[2-[1-[(1-naphthalen-1-ylcyclopropyl)amino]prop-1-enyl]phenyl]methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 171822123 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | N-but-2-ynyl-2-[[2-[1-[(1-naphthalen-1-ylcyclopropyl)amino]prop-1-enyl]phenyl]methylamino]prop-2-enamide |
| SMILES | C=C(NCc1ccccc1C(=CC)NC1(c2cccc3ccccc23)CC1)C(=O)NCC#CC |
| InChI | InChI=1S/C30H31N3O/c1-4-6-20-31-29(34)22(3)32-21-24-13-8-10-16-26(24)28(5-2)33-30(18-19-30)27-17-11-14-23-12-7-9-15-25(23)27/h5,7-17,32-33H,3,18-21H2,1-2H3,(H,31,34) |
| InChIKey | DGIJKZJLTCNQLG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|