C32H33N3O4 — CID 171821526
N-methoxy-N-methyl-4-[[3-[[2-[2-(1-naphthalen-1-ylcyclopropyl)propanoyl]phenyl]methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-ynamide (PubChem CID 171821526) has the molecular formula C32H33N3O4 and a molecular weight of 523.63 g/mol. Its IUPAC name is N-methoxy-N-methyl-4-[[3-[[2-[2-(1-naphthalen-1-ylcyclopropyl)propanoyl]phenyl]methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-ynamide.
| Compound Name | N-methoxy-N-methyl-4-[[3-[[2-[2-(1-naphthalen-1-ylcyclopropyl)propanoyl]phenyl]methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-ynamide |
|---|---|
| PubChem CID | 171821526 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | N-methoxy-N-methyl-4-[[3-[[2-[2-(1-naphthalen-1-ylcyclopropyl)propanoyl]phenyl]methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-ynamide |
| SMILES | C=C(NCC#CC(=O)N(C)OC)C(=O)NCc1ccccc1C(=O)C(C)C1(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H33N3O4/c1-22(32(18-19-32)28-16-9-13-24-11-5-7-14-26(24)28)30(37)27-15-8-6-12-25(27)21-34-31(38)23(2)33-20-10-17-29(36)35(3)39-4/h5-9,11-16,22,33H,2,18-21H2,1,3-4H3,(H,34,38) |
| InChIKey | MPHFQMKTWICKPP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|