C35H38FN3O3 — CID 171821522
N-[(2-acetylphenyl)methyl]-2-[[4-(3-fluoro-3-methylazetidin-1-yl)-4-oxobut-2-ynyl]amino]but-2-enamide;1-(1-methylcyclopropyl)naphthalene (PubChem CID 171821522) has the molecular formula C35H38FN3O3 and a molecular weight of 567.71 g/mol. Its IUPAC name is N-[(2-acetylphenyl)methyl]-2-[[4-(3-fluoro-3-methylazetidin-1-yl)-4-oxobut-2-ynyl]amino]but-2-enamide;1-(1-methylcyclopropyl)naphthalene.
| Compound Name | N-[(2-acetylphenyl)methyl]-2-[[4-(3-fluoro-3-methylazetidin-1-yl)-4-oxobut-2-ynyl]amino]but-2-enamide;1-(1-methylcyclopropyl)naphthalene |
|---|---|
| PubChem CID | 171821522 |
| Molecular Formula | C35H38FN3O3 |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | N-[(2-acetylphenyl)methyl]-2-[[4-(3-fluoro-3-methylazetidin-1-yl)-4-oxobut-2-ynyl]amino]but-2-enamide;1-(1-methylcyclopropyl)naphthalene |
| SMILES | CC1(c2cccc3ccccc23)CC1.CC=C(NCC#CC(=O)N1CC(C)(F)C1)C(=O)NCc1ccccc1C(C)=O |
| InChI | InChI=1S/C21H24FN3O3.C14H14/c1-4-18(23-11-7-10-19(27)25-13-21(3,22)14-25)20(28)24-12-16-8-5-6-9-17(16)15(2)26;1-14(9-10-14)13-8-4-6-11-5-2-3-7-12(11)13/h4-6,8-9,23H,11-14H2,1-3H3,(H,24,28);2-8H,9-10H2,1H3 |
| InChIKey | HJXRLLAOJBLGDL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|