C19H24N2O4 — CID 171822016
propan-2-yl (E)-4-[[3-[(2-acetylphenyl)methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-enoate (PubChem CID 171822016) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is propan-2-yl (E)-4-[[3-[(2-acetylphenyl)methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-enoate.
| Compound Name | propan-2-yl (E)-4-[[3-[(2-acetylphenyl)methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 171822016 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | propan-2-yl (E)-4-[[3-[(2-acetylphenyl)methylamino]-3-oxoprop-1-en-2-yl]amino]but-2-enoate |
| SMILES | C=C(NC/C=C/C(=O)OC(C)C)C(=O)NCc1ccccc1C(C)=O |
| InChI | InChI=1S/C19H24N2O4/c1-13(2)25-18(23)10-7-11-20-14(3)19(24)21-12-16-8-5-6-9-17(16)15(4)22/h5-10,13,20H,3,11-12H2,1-2,4H3,(H,21,24)/b10-7+ |
| InChIKey | SMNCDNJPPHGAIE-JXMROGBWSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|