C12H13ClN2 — CID 118658353
1-(2-chloroquinolin-5-yl)-N,N-dimethylmethanamine (PubChem CID 118658353) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 1-(2-chloroquinolin-5-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-chloroquinolin-5-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 118658353 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(2-chloroquinolin-5-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C12H13ClN2/c1-15(2)8-9-4-3-5-11-10(9)6-7-12(13)14-11/h3-7H,8H2,1-2H3 |
| InChIKey | VPSGDLCOPRNNBJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|