C13H22N2Se — CID 11832995
1-[3-[(dimethylamino)methyl]-2-methylselanylphenyl]-N,N-dimethylmethanamine (PubChem CID 11832995) has the molecular formula C13H22N2Se and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-2-methylselanylphenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[(dimethylamino)methyl]-2-methylselanylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 11832995 |
| Molecular Formula | C13H22N2Se |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-2-methylselanylphenyl]-N,N-dimethylmethanamine |
| SMILES | C[Se]c1c(CN(C)C)cccc1CN(C)C |
| InChI | InChI=1S/C13H22N2Se/c1-14(2)9-11-7-6-8-12(10-15(3)4)13(11)16-5/h6-8H,9-10H2,1-5H3 |
| InChIKey | NKMJJFXHXSIEDJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|