C12H21Cl2N2P — CID 16687657
[2,6-bis[(dimethylamino)methyl]phenyl]-chlorophosphanium chloride (PubChem CID 16687657) has the molecular formula C12H21Cl2N2P and a molecular weight of 295.19 g/mol. Its IUPAC name is [2,6-bis[(dimethylamino)methyl]phenyl]-chlorophosphanium chloride.
| Compound Name | [2,6-bis[(dimethylamino)methyl]phenyl]-chlorophosphanium chloride |
|---|---|
| PubChem CID | 16687657 |
| Molecular Formula | C12H21Cl2N2P |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [2,6-bis[(dimethylamino)methyl]phenyl]-chlorophosphanium chloride |
| SMILES | CN(C)Cc1cccc(CN(C)C)c1[PH2+]Cl.[Cl-] |
| InChI | InChI=1S/C12H20ClN2P.ClH/c1-14(2)8-10-6-5-7-11(9-15(3)4)12(10)16-13;/h5-7,16H,8-9H2,1-4H3;1H |
| InChIKey | WVLCUUBTGKBACQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|