C33H32N4O2 — CID 171822436
2-[[(E)-3-(1,2-dihydropyridin-6-yl)prop-2-enyl]amino]-N-[[2-[2-imino-2-(1-naphthalen-2-ylcyclopropyl)acetyl]phenyl]methyl]prop-2-enamide (PubChem CID 171822436) has the molecular formula C33H32N4O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 2-[[(E)-3-(1,2-dihydropyridin-6-yl)prop-2-enyl]amino]-N-[[2-[2-imino-2-(1-naphthalen-2-ylcyclopropyl)acetyl]phenyl]methyl]prop-2-enamide.
| Compound Name | 2-[[(E)-3-(1,2-dihydropyridin-6-yl)prop-2-enyl]amino]-N-[[2-[2-imino-2-(1-naphthalen-2-ylcyclopropyl)acetyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 171822436 |
| Molecular Formula | C33H32N4O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 2-[[(E)-3-(1,2-dihydropyridin-6-yl)prop-2-enyl]amino]-N-[[2-[2-imino-2-(1-naphthalen-2-ylcyclopropyl)acetyl]phenyl]methyl]prop-2-enamide |
| SMILES | [H]/N=C(\C(=O)c1ccccc1CNC(=O)C(=C)NC/C=C/C1=CC=CCN1)C1(c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C33H32N4O2/c1-23(35-20-8-13-28-12-6-7-19-36-28)32(39)37-22-26-11-4-5-14-29(26)30(38)31(34)33(17-18-33)27-16-15-24-9-2-3-10-25(24)21-27/h2-16,21,34-36H,1,17-20,22H2,(H,37,39)/b13-8+,34-31+ |
| InChIKey | XXRRVGFMFOULJA-PRMTYNRMSA-N |
| XLogP | 5.09 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|