C20H23N3O4S2 — CID 171822702
4-[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]thiomorpholine-3-carboxamide (PubChem CID 171822702) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]thiomorpholine-3-carboxamide.
| Compound Name | 4-[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 171822702 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]thiomorpholine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2cccc(C(=O)N3CCSCC3C(N)=O)c2)c1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-13-6-7-14(2)18(10-13)29(26,27)22-16-5-3-4-15(11-16)20(25)23-8-9-28-12-17(23)19(21)24/h3-7,10-11,17,22H,8-9,12H2,1-2H3,(H2,21,24) |
| InChIKey | XKYHSLYQEGFZHM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |