C13H16N2O4S2 — CID 175925267
4-(3-methylsulfonylbenzoyl)thiomorpholine-3-carboxamide (PubChem CID 175925267) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(3-methylsulfonylbenzoyl)thiomorpholine-3-carboxamide.
| Compound Name | 4-(3-methylsulfonylbenzoyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 175925267 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-(3-methylsulfonylbenzoyl)thiomorpholine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N2CCSCC2C(N)=O)c1 |
| InChI | InChI=1S/C13H16N2O4S2/c1-21(18,19)10-4-2-3-9(7-10)13(17)15-5-6-20-8-11(15)12(14)16/h2-4,7,11H,5-6,8H2,1H3,(H2,14,16) |
| InChIKey | WBFAGYZMTKQOOM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |