C11H13F4N3O — CID 171823030
N'-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylpropanehydrazide (PubChem CID 171823030) has the molecular formula C11H13F4N3O and a molecular weight of 279.24 g/mol. Its IUPAC name is N'-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylpropanehydrazide.
| Compound Name | N'-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylpropanehydrazide |
|---|---|
| PubChem CID | 171823030 |
| Molecular Formula | C11H13F4N3O |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N'-[[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylpropanehydrazide |
| SMILES | CCC(=O)N(C)NCc1ncc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C11H13F4N3O/c1-3-10(19)18(2)17-6-9-8(12)4-7(5-16-9)11(13,14)15/h4-5,17H,3,6H2,1-2H3 |
| InChIKey | QAOMIGBCELCGMP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|