C17H22BrF2NO4 — CID 171825950
ethyl (3S)-3-(3-bromo-2,6-difluoro-5-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 171825950) has the molecular formula C17H22BrF2NO4 and a molecular weight of 422.27 g/mol. Its IUPAC name is ethyl (3S)-3-(3-bromo-2,6-difluoro-5-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (3S)-3-(3-bromo-2,6-difluoro-5-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 171825950 |
| Molecular Formula | C17H22BrF2NO4 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | ethyl (3S)-3-(3-bromo-2,6-difluoro-5-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)OC(C)(C)C)c1c(F)c(C)cc(Br)c1F |
| InChI | InChI=1S/C17H22BrF2NO4/c1-6-24-12(22)8-11(21-16(23)25-17(3,4)5)13-14(19)9(2)7-10(18)15(13)20/h7,11H,6,8H2,1-5H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | PQRYYLFCGLSZLM-NSHDSACASA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|