C15H11Cl2NO2S — CID 171827359
S-[5-(3,4-dichlorobenzoyl)-2-(methylamino)phenyl] methanethioate (PubChem CID 171827359) has the molecular formula C15H11Cl2NO2S and a molecular weight of 340.23 g/mol. Its IUPAC name is S-[5-(3,4-dichlorobenzoyl)-2-(methylamino)phenyl] methanethioate.
| Compound Name | S-[5-(3,4-dichlorobenzoyl)-2-(methylamino)phenyl] methanethioate |
|---|---|
| PubChem CID | 171827359 |
| Molecular Formula | C15H11Cl2NO2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | S-[5-(3,4-dichlorobenzoyl)-2-(methylamino)phenyl] methanethioate |
| SMILES | CNc1ccc(C(=O)c2ccc(Cl)c(Cl)c2)cc1SC=O |
| InChI | InChI=1S/C15H11Cl2NO2S/c1-18-13-5-3-10(7-14(13)21-8-19)15(20)9-2-4-11(16)12(17)6-9/h2-8,18H,1H3 |
| InChIKey | MASYJQZKSMMDJE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|