About ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate
ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate (PubChem CID 142337578) has the molecular formula C11H17NOS
and a molecular weight of 211.33 g/mol. Its IUPAC name is ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate.
Molecular Properties
| Compound Name | ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate |
| PubChem CID | 142337578 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate |
| SMILES | CC.CNc1ccc(C)cc1SC=O |
| InChI | InChI=1S/C9H11NOS.C2H6/c1-7-3-4-8(10-2)9(5-7)12-6-11;1-2/h3-6,10H,1-2H3;1-2H3 |
| InChIKey | VFCCVJOMTLCENU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate?
The IUPAC name of ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate (CID 142337578) is ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate.
What is the SMILES notation for ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate?
The canonical SMILES for ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate is CC.CNc1ccc(C)cc1SC=O.
What is the InChIKey of ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate?
The InChIKey is VFCCVJOMTLCENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS.C2H6/c1-7-3-4-8(10-2)9(5-7)12-6-11;1-2/h3-6,10H,1-2H3;1-2H3.
What are the key properties of ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate?
ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate has a molecular weight of 211.33 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-[5-methyl-2-(methylamino)phenyl] methanethioate is sourced from PubChem (CID 142337578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).