C23H26N4O4 — CID 171830345
4-[[(2S)-1,4-dioxan-2-yl]methyl]-14-methyl-N-(1,3-oxazol-2-ylmethyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-12-carboxamide (PubChem CID 171830345) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 4-[[(2S)-1,4-dioxan-2-yl]methyl]-14-methyl-N-(1,3-oxazol-2-ylmethyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-12-carboxamide.
| Compound Name | 4-[[(2S)-1,4-dioxan-2-yl]methyl]-14-methyl-N-(1,3-oxazol-2-ylmethyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-12-carboxamide |
|---|---|
| PubChem CID | 171830345 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-[[(2S)-1,4-dioxan-2-yl]methyl]-14-methyl-N-(1,3-oxazol-2-ylmethyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,5,11,13-pentaene-12-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ncco2)cc2c1-c1nn(C[C@H]3COCCO3)cc1CCC2 |
| InChI | InChI=1S/C23H26N4O4/c1-15-9-18(23(28)25-11-20-24-5-6-31-20)10-16-3-2-4-17-12-27(26-22(17)21(15)16)13-19-14-29-7-8-30-19/h5-6,9-10,12,19H,2-4,7-8,11,13-14H2,1H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | FTDWAVAEZYXIAU-IBGZPJMESA-N |
| XLogP | 2.68 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |