C23H18F6O — CID 171832360
1-methoxy-4-[[4-prop-2-enyl-2,6-bis(trifluoromethyl)phenyl]methyl]naphthalene (PubChem CID 171832360) has the molecular formula C23H18F6O and a molecular weight of 424.38 g/mol. Its IUPAC name is 1-methoxy-4-[[4-prop-2-enyl-2,6-bis(trifluoromethyl)phenyl]methyl]naphthalene.
| Compound Name | 1-methoxy-4-[[4-prop-2-enyl-2,6-bis(trifluoromethyl)phenyl]methyl]naphthalene |
|---|---|
| PubChem CID | 171832360 |
| Molecular Formula | C23H18F6O |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-methoxy-4-[[4-prop-2-enyl-2,6-bis(trifluoromethyl)phenyl]methyl]naphthalene |
| SMILES | C=CCc1cc(C(F)(F)F)c(Cc2ccc(OC)c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F6O/c1-3-6-14-11-19(22(24,25)26)18(20(12-14)23(27,28)29)13-15-9-10-21(30-2)17-8-5-4-7-16(15)17/h3-5,7-12H,1,6,13H2,2H3 |
| InChIKey | OGFKDFZHMXOGCT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|