C16H24N2O3S — CID 171832388
tert-butyl N-[(2,4-dimethylphenyl)methyl-methylsulfanylcarbonylamino]carbamate (PubChem CID 171832388) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl N-[(2,4-dimethylphenyl)methyl-methylsulfanylcarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(2,4-dimethylphenyl)methyl-methylsulfanylcarbonylamino]carbamate |
|---|---|
| PubChem CID | 171832388 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[(2,4-dimethylphenyl)methyl-methylsulfanylcarbonylamino]carbamate |
| SMILES | CSC(=O)N(Cc1ccc(C)cc1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O3S/c1-11-7-8-13(12(2)9-11)10-18(15(20)22-6)17-14(19)21-16(3,4)5/h7-9H,10H2,1-6H3,(H,17,19) |
| InChIKey | WPAYDXVMXKSTMM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|