C11H21N — CID 171833508
(E)-3-ethyl-N,6-dimethylhept-2-en-1-imine (PubChem CID 171833508) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (E)-3-ethyl-N,6-dimethylhept-2-en-1-imine.
| Compound Name | (E)-3-ethyl-N,6-dimethylhept-2-en-1-imine |
|---|---|
| PubChem CID | 171833508 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (E)-3-ethyl-N,6-dimethylhept-2-en-1-imine |
| SMILES | CC/C(=C\C=N\C)CCC(C)C |
| InChI | InChI=1S/C11H21N/c1-5-11(8-9-12-4)7-6-10(2)3/h8-10H,5-7H2,1-4H3/b11-8+,12-9+ |
| InChIKey | CPGBZKBEXMWDQH-HZOWPXDZSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|