C17H19Cl2FN4OSi — CID 171839779
2-[[3-(2,5-dichloropyrimidin-4-yl)-5-fluoroindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171839779) has the molecular formula C17H19Cl2FN4OSi and a molecular weight of 413.36 g/mol. Its IUPAC name is 2-[[3-(2,5-dichloropyrimidin-4-yl)-5-fluoroindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2,5-dichloropyrimidin-4-yl)-5-fluoroindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171839779 |
| Molecular Formula | C17H19Cl2FN4OSi |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[[3-(2,5-dichloropyrimidin-4-yl)-5-fluoroindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2nc(Cl)ncc2Cl)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H19Cl2FN4OSi/c1-26(2,3)7-6-25-10-24-14-5-4-11(20)8-12(14)15(23-24)16-13(18)9-21-17(19)22-16/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | UZKXVYZLQKDRJS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|