C21H31NO4 — CID 171841242
tert-butyl N-[(2S)-3-phenylmethoxy-2-prop-2-enoxypropyl]-N-prop-2-enylcarbamate (PubChem CID 171841242) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-phenylmethoxy-2-prop-2-enoxypropyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(2S)-3-phenylmethoxy-2-prop-2-enoxypropyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 171841242 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl N-[(2S)-3-phenylmethoxy-2-prop-2-enoxypropyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCO[C@H](COCc1ccccc1)CN(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO4/c1-6-13-22(20(23)26-21(3,4)5)15-19(25-14-7-2)17-24-16-18-11-9-8-10-12-18/h6-12,19H,1-2,13-17H2,3-5H3/t19-/m0/s1 |
| InChIKey | HGIOXJVDRAHYTK-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|