C21H40N2O5 — CID 171841578
tert-butyl N-[2-[2-[3-[[3-methyl-3-(2-methylpropyl)cyclobutyl]amino]-3-oxopropoxy]ethoxy]ethyl]carbamate (PubChem CID 171841578) has the molecular formula C21H40N2O5 and a molecular weight of 400.56 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-[[3-methyl-3-(2-methylpropyl)cyclobutyl]amino]-3-oxopropoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-[[3-methyl-3-(2-methylpropyl)cyclobutyl]amino]-3-oxopropoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 171841578 |
| Molecular Formula | C21H40N2O5 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | tert-butyl N-[2-[2-[3-[[3-methyl-3-(2-methylpropyl)cyclobutyl]amino]-3-oxopropoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)CC1(C)CC(NC(=O)CCOCCOCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H40N2O5/c1-16(2)13-21(6)14-17(15-21)23-18(24)7-9-26-11-12-27-10-8-22-19(25)28-20(3,4)5/h16-17H,7-15H2,1-6H3,(H,22,25)(H,23,24) |
| InChIKey | JKEVGFCHQWKYIG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|