C17H10BrF4NO3 — CID 171842386
3-[[7-bromo-5-(trifluoromethoxy)indol-1-yl]methyl]-2-fluorobenzoic acid (PubChem CID 171842386) has the molecular formula C17H10BrF4NO3 and a molecular weight of 432.17 g/mol. Its IUPAC name is 3-[[7-bromo-5-(trifluoromethoxy)indol-1-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 3-[[7-bromo-5-(trifluoromethoxy)indol-1-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 171842386 |
| Molecular Formula | C17H10BrF4NO3 |
| Molecular Weight | 432.17 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 3-[[7-bromo-5-(trifluoromethoxy)indol-1-yl]methyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cn2ccc3cc(OC(F)(F)F)cc(Br)c32)c1F |
| InChI | InChI=1S/C17H10BrF4NO3/c18-13-7-11(26-17(20,21)22)6-9-4-5-23(15(9)13)8-10-2-1-3-12(14(10)19)16(24)25/h1-7H,8H2,(H,24,25) |
| InChIKey | LNSWXZVJLADPFP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |