C26H43KN2O7 — CID 171843475
potassium N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 171843475) has the molecular formula C26H43KN2O7 and a molecular weight of 534.74 g/mol. Its IUPAC name is potassium N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | potassium N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 171843475 |
| Molecular Formula | C26H43KN2O7 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | potassium N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | [CH2-]C(CC)NC(=O)CCOCCOCCOCCOCCNC(=O)CCCc1ccc(OC)cc1.[K+] |
| InChI | InChI=1S/C26H43N2O7.K/c1-4-22(2)28-26(30)12-14-32-16-18-34-20-21-35-19-17-33-15-13-27-25(29)7-5-6-23-8-10-24(31-3)11-9-23;/h8-11,22H,2,4-7,12-21H2,1,3H3,(H,27,29)(H,28,30);/q-1;+1 |
| InChIKey | WWQYBMVVSQHMML-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|