C26H44N2O7 — CID 171843476
N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 171843476) has the molecular formula C26H44N2O7 and a molecular weight of 496.65 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 171843476 |
| Molecular Formula | C26H44N2O7 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | N-[2-[2-[2-[2-[3-(butan-2-ylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | CCC(C)NC(=O)CCOCCOCCOCCOCCNC(=O)CCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H44N2O7/c1-4-22(2)28-26(30)12-14-32-16-18-34-20-21-35-19-17-33-15-13-27-25(29)7-5-6-23-8-10-24(31-3)11-9-23/h8-11,22H,4-7,12-21H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | MSROUOSSJGQFFY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|