C22H17FO5S2 — CID 171849237
(4-acetyl-14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-10-yl) 1-cyclopropyl-1-fluoroethanesulfonate (PubChem CID 171849237) has the molecular formula C22H17FO5S2 and a molecular weight of 444.51 g/mol. Its IUPAC name is (4-acetyl-14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-10-yl) 1-cyclopropyl-1-fluoroethanesulfonate.
| Compound Name | (4-acetyl-14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-10-yl) 1-cyclopropyl-1-fluoroethanesulfonate |
|---|---|
| PubChem CID | 171849237 |
| Molecular Formula | C22H17FO5S2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (4-acetyl-14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-10-yl) 1-cyclopropyl-1-fluoroethanesulfonate |
| SMILES | CC(=O)c1ccc2cc3c(OS(=O)(=O)C(C)(F)C4CC4)ccc4c3c(c2c1)SC4=O |
| InChI | InChI=1S/C22H17FO5S2/c1-11(24)12-3-4-13-10-17-18(28-30(26,27)22(2,23)14-5-6-14)8-7-15-19(17)20(16(13)9-12)29-21(15)25/h3-4,7-10,14H,5-6H2,1-2H3 |
| InChIKey | YCZRPSUUBVCLPV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|