C17H8F4O3S2 — CID 171849221
4-fluoro-10-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one (PubChem CID 171849221) has the molecular formula C17H8F4O3S2 and a molecular weight of 400.37 g/mol. Its IUPAC name is 4-fluoro-10-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one.
| Compound Name | 4-fluoro-10-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one |
|---|---|
| PubChem CID | 171849221 |
| Molecular Formula | C17H8F4O3S2 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 4-fluoro-10-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9,11,13(16)-heptaen-14-one |
| SMILES | C=S(=O)(Oc1ccc2c3c(c4cc(F)ccc4cc13)SC2=O)C(F)(F)F |
| InChI | InChI=1S/C17H8F4O3S2/c1-26(23,17(19,20)21)24-13-5-4-10-14-12(13)6-8-2-3-9(18)7-11(8)15(14)25-16(10)22/h2-7H,1H2 |
| InChIKey | NFJQYZFRHKEMFR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|