C16H7F3O4S2 — CID 171849211
(14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-10-yl) trifluoromethanesulfonate (PubChem CID 171849211) has the molecular formula C16H7F3O4S2 and a molecular weight of 384.36 g/mol. Its IUPAC name is (14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-10-yl) trifluoromethanesulfonate.
| Compound Name | (14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-10-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171849211 |
| Molecular Formula | C16H7F3O4S2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | (14-oxo-15-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaen-10-yl) trifluoromethanesulfonate |
| SMILES | O=C1Sc2c3ccccc3cc3c(OS(=O)(=O)C(F)(F)F)ccc1c23 |
| InChI | InChI=1S/C16H7F3O4S2/c17-16(18,19)25(21,22)23-12-6-5-10-13-11(12)7-8-3-1-2-4-9(8)14(13)24-15(10)20/h1-7H |
| InChIKey | FAKTYVLIVOEAKN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|