C17H30N4O2 — CID 171849727
ethyl (6R)-6-(4-propanimidoylpiperazin-1-yl)-2-azaspiro[3.4]octane-2-carboxylate (PubChem CID 171849727) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is ethyl (6R)-6-(4-propanimidoylpiperazin-1-yl)-2-azaspiro[3.4]octane-2-carboxylate.
| Compound Name | ethyl (6R)-6-(4-propanimidoylpiperazin-1-yl)-2-azaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 171849727 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethyl (6R)-6-(4-propanimidoylpiperazin-1-yl)-2-azaspiro[3.4]octane-2-carboxylate |
| SMILES | [H]/N=C(\CC)N1CCN([C@@H]2CCC3(C2)CN(C(=O)OCC)C3)CC1 |
| InChI | InChI=1S/C17H30N4O2/c1-3-15(18)20-9-7-19(8-10-20)14-5-6-17(11-14)12-21(13-17)16(22)23-4-2/h14,18H,3-13H2,1-2H3/b18-15+/t14-/m1/s1 |
| InChIKey | GMCMPWUQKKYHNF-GBUWSYLDSA-N |
| XLogP | 2.00 |
| TPSA | 59.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|