C18H31N3O2 — CID 175632058
ethyl 6-[4-(ethyliminomethyl)piperidin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate (PubChem CID 175632058) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is ethyl 6-[4-(ethyliminomethyl)piperidin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate.
| Compound Name | ethyl 6-[4-(ethyliminomethyl)piperidin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 175632058 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | ethyl 6-[4-(ethyliminomethyl)piperidin-1-yl]-2-azaspiro[3.4]octane-2-carboxylate |
| SMILES | CC/N=C/C1CCN(C2CCC3(C2)CN(C(=O)OCC)C3)CC1 |
| InChI | InChI=1S/C18H31N3O2/c1-3-19-12-15-6-9-20(10-7-15)16-5-8-18(11-16)13-21(14-18)17(22)23-4-2/h12,15-16H,3-11,13-14H2,1-2H3/b19-12+ |
| InChIKey | QGTUBBCZMFYILJ-XDHOZWIPSA-N |
| XLogP | 2.80 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|