C21H24FN5O2 — CID 171852169
[5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenyl] formate (PubChem CID 171852169) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is [5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenyl] formate.
| Compound Name | [5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenyl] formate |
|---|---|
| PubChem CID | 171852169 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenyl] formate |
| SMILES | CCc1cc(F)c(-c2nnc(N[C@@H]3CCCN(C)C3)n3cccc23)c(OC=O)c1 |
| InChI | InChI=1S/C21H24FN5O2/c1-3-14-10-16(22)19(18(11-14)29-13-28)20-17-7-5-9-27(17)21(25-24-20)23-15-6-4-8-26(2)12-15/h5,7,9-11,13,15H,3-4,6,8,12H2,1-2H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | TWERZUYIECACMJ-OAHLLOKOSA-N |
| XLogP | 3.14 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|