C20H21F4N5O — CID 175599286
3-fluoro-5-methyl-2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol (PubChem CID 175599286) has the molecular formula C20H21F4N5O and a molecular weight of 423.41 g/mol. Its IUPAC name is 3-fluoro-5-methyl-2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol.
| Compound Name | 3-fluoro-5-methyl-2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol |
|---|---|
| PubChem CID | 175599286 |
| Molecular Formula | C20H21F4N5O |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-fluoro-5-methyl-2-[4-[[(3R)-1-(1,2,2-trifluoroethyl)piperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol |
| SMILES | Cc1cc(O)c(-c2nnc(N[C@@H]3CCCN(C(F)C(F)F)C3)n3cccc23)c(F)c1 |
| InChI | InChI=1S/C20H21F4N5O/c1-11-8-13(21)16(15(30)9-11)17-14-5-3-7-29(14)20(27-26-17)25-12-4-2-6-28(10-12)19(24)18(22)23/h3,5,7-9,12,18-19,30H,2,4,6,10H2,1H3,(H,25,27)/t12-,19?/m1/s1 |
| InChIKey | BRIMUNSSSLKDAH-ISGGMURCSA-N |
| XLogP | 3.99 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|