C21H26FN5O3 — CID 175599335
5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol;formic acid (PubChem CID 175599335) has the molecular formula C21H26FN5O3 and a molecular weight of 415.47 g/mol. Its IUPAC name is 5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol;formic acid.
| Compound Name | 5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol;formic acid |
|---|---|
| PubChem CID | 175599335 |
| Molecular Formula | C21H26FN5O3 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-ethyl-3-fluoro-2-[4-[[(3R)-1-methylpiperidin-3-yl]amino]pyrrolo[1,2-d][1,2,4]triazin-1-yl]phenol;formic acid |
| SMILES | CCc1cc(O)c(-c2nnc(N[C@@H]3CCCN(C)C3)n3cccc23)c(F)c1.O=CO |
| InChI | InChI=1S/C20H24FN5O.CH2O2/c1-3-13-10-15(21)18(17(27)11-13)19-16-7-5-9-26(16)20(24-23-19)22-14-6-4-8-25(2)12-14;2-1-3/h5,7,9-11,14,27H,3-4,6,8,12H2,1-2H3,(H,22,24);1H,(H,2,3)/t14-;/m1./s1 |
| InChIKey | IERBLGXWYZCCCY-PFEQFJNWSA-N |
| XLogP | 3.01 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|